C23H20BrNO4 — CID 126221971
4-[[4-bromo-2-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid (PubChem CID 126221971) has the molecular formula C23H20BrNO4 and a molecular weight of 454.32 g/mol. Its IUPAC name is 4-[[4-bromo-2-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid.
| Compound Name | 4-[[4-bromo-2-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126221971 |
| Molecular Formula | C23H20BrNO4 |
| Molecular Weight | 454.32 g/mol |
| Exact Mass | 453.06 |
| IUPAC Name | 4-[[4-bromo-2-[(4-ethoxyphenyl)iminomethyl]phenoxy]methyl]benzoic acid |
| SMILES | CCOc1ccc(/N=C/c2cc(Br)ccc2OCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H20BrNO4/c1-2-28-21-10-8-20(9-11-21)25-14-18-13-19(24)7-12-22(18)29-15-16-3-5-17(6-4-16)23(26)27/h3-14H,2,15H2,1H3,(H,26,27)/b25-14+ |
| InChIKey | ASNQRYHBYLLCEH-AFUMVMLFSA-N |
| XLogP | 5.88 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.32 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|