C18H19BrN2O4S — CID 4848013
4-bromo-2-[(2-methyl-5-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol (PubChem CID 4848013) has the molecular formula C18H19BrN2O4S and a molecular weight of 439.33 g/mol. Its IUPAC name is 4-bromo-2-[(2-methyl-5-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol.
| Compound Name | 4-bromo-2-[(2-methyl-5-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 4848013 |
| Molecular Formula | C18H19BrN2O4S |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 438.02 |
| IUPAC Name | 4-bromo-2-[(2-methyl-5-morpholin-4-ylsulfonylphenyl)iminomethyl]phenol |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C18H19BrN2O4S/c1-13-2-4-16(26(23,24)21-6-8-25-9-7-21)11-17(13)20-12-14-10-15(19)3-5-18(14)22/h2-5,10-12,22H,6-9H2,1H3/b20-12+ |
| InChIKey | TYOMZICGZKLEEF-UDWIEESQSA-N |
| XLogP | 3.23 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|