C18H17NO6 — CID 135595457
dimethyl 5-[(2-hydroxy-5-methoxyphenyl)methylideneamino]benzene-1,3-dicarboxylate (PubChem CID 135595457) has the molecular formula C18H17NO6 and a molecular weight of 343.34 g/mol. Its IUPAC name is dimethyl 5-[(2-hydroxy-5-methoxyphenyl)methylideneamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-hydroxy-5-methoxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 135595457 |
| Molecular Formula | C18H17NO6 |
| Molecular Weight | 343.34 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | dimethyl 5-[(2-hydroxy-5-methoxyphenyl)methylideneamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(/N=C/c2cc(OC)ccc2O)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H17NO6/c1-23-15-4-5-16(20)13(9-15)10-19-14-7-11(17(21)24-2)6-12(8-14)18(22)25-3/h4-10,20H,1-3H3/b19-10+ |
| InChIKey | MZHLRHSUVFMBKL-VXLYETTFSA-N |
| XLogP | 2.72 |
| TPSA | 94.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|