C19H15BrCl2N2O5 — CID 3664727
4-[(2-bromo-4,5-dichlorophenyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol (PubChem CID 3664727) has the molecular formula C19H15BrCl2N2O5 and a molecular weight of 502.15 g/mol. Its IUPAC name is 4-[(2-bromo-4,5-dichlorophenyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol.
| Compound Name | 4-[(2-bromo-4,5-dichlorophenyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol |
|---|---|
| PubChem CID | 3664727 |
| Molecular Formula | C19H15BrCl2N2O5 |
| Molecular Weight | 502.15 g/mol |
| Exact Mass | 499.95 |
| IUPAC Name | 4-[(2-bromo-4,5-dichlorophenyl)iminomethyl]-2-(3,4,5-trimethoxyphenyl)-1,3-oxazol-5-ol |
| SMILES | COc1cc(-c2nc(/C=N/c3cc(Cl)c(Cl)cc3Br)c(O)o2)cc(OC)c1OC |
| InChI | InChI=1S/C19H15BrCl2N2O5/c1-26-15-4-9(5-16(27-2)17(15)28-3)18-24-14(19(25)29-18)8-23-13-7-12(22)11(21)6-10(13)20/h4-8,25H,1-3H3/b23-8+ |
| InChIKey | JORDZIGTCKDRSD-LIMNOBDPSA-N |
| XLogP | 5.89 |
| TPSA | 86.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.15 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|