C21H18N4O5 — CID 135751887
3-[(E)-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one (PubChem CID 135751887) has the molecular formula C21H18N4O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is 3-[(E)-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one.
| Compound Name | 3-[(E)-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 135751887 |
| Molecular Formula | C21H18N4O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | 3-[(E)-(5-hydroxy-2-phenyl-1,3-oxazol-4-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
| SMILES | COc1cc2nc(C)n(/N=C/c3nc(-c4ccccc4)oc3O)c(=O)c2cc1OC |
| InChI | InChI=1S/C21H18N4O5/c1-12-23-15-10-18(29-3)17(28-2)9-14(15)20(26)25(12)22-11-16-21(27)30-19(24-16)13-7-5-4-6-8-13/h4-11,27H,1-3H3/b22-11+ |
| InChIKey | MYBIGCNGUVCOSZ-SSDVNMTOSA-N |
| XLogP | 2.96 |
| TPSA | 111.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|