C28H31N3O5 — CID 135822423
3-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one (PubChem CID 135822423) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is 3-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one.
| Compound Name | 3-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 135822423 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | 3-[(E)-(3-tert-butyl-2-hydroxy-6,7,8,9-tetrahydrodibenzofuran-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
| SMILES | COc1cc2nc(C)n(/N=C/c3c(O)c(C(C)(C)C)cc4oc5c(c34)CCCC5)c(=O)c2cc1OC |
| InChI | InChI=1S/C28H31N3O5/c1-15-30-20-13-23(35-6)22(34-5)11-17(20)27(33)31(15)29-14-18-25-16-9-7-8-10-21(16)36-24(25)12-19(26(18)32)28(2,3)4/h11-14,32H,7-10H2,1-6H3/b29-14+ |
| InChIKey | GCJCZSPQSYLIOD-IPPBACCNSA-N |
| XLogP | 5.23 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|