C22H18BrN3O4 — CID 135821827
3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one (PubChem CID 135821827) has the molecular formula C22H18BrN3O4 and a molecular weight of 468.31 g/mol. Its IUPAC name is 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one.
| Compound Name | 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 135821827 |
| Molecular Formula | C22H18BrN3O4 |
| Molecular Weight | 468.31 g/mol |
| Exact Mass | 467.05 |
| IUPAC Name | 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-6,7-dimethoxy-2-methylquinazolin-4-one |
| SMILES | COc1cc2nc(C)n(/N=C/c3c(O)ccc4cc(Br)ccc34)c(=O)c2cc1OC |
| InChI | InChI=1S/C22H18BrN3O4/c1-12-25-18-10-21(30-3)20(29-2)9-16(18)22(28)26(12)24-11-17-15-6-5-14(23)8-13(15)4-7-19(17)27/h4-11,27H,1-3H3/b24-11+ |
| InChIKey | MCAWPQGLRXOXPE-BHGWPJFGSA-N |
| XLogP | 4.23 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|