C22H18BrN3O2 — CID 135650599
3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-2-propylquinazolin-4-one (PubChem CID 135650599) has the molecular formula C22H18BrN3O2 and a molecular weight of 436.31 g/mol. Its IUPAC name is 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 135650599 |
| Molecular Formula | C22H18BrN3O2 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.06 |
| IUPAC Name | 3-[(E)-(6-bromo-2-hydroxynaphthalen-1-yl)methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccccc2c(=O)n1/N=C/c1c(O)ccc2cc(Br)ccc12 |
| InChI | InChI=1S/C22H18BrN3O2/c1-2-5-21-25-19-7-4-3-6-17(19)22(28)26(21)24-13-18-16-10-9-15(23)12-14(16)8-11-20(18)27/h3-4,6-13,27H,2,5H2,1H3/b24-13+ |
| InChIKey | NTPWASRDBUMPSE-ZMOGYAJESA-N |
| XLogP | 4.85 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|