C22H25N3O6 — CID 4516911
6,7-dimethoxy-2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinazolin-4-one (PubChem CID 4516911) has the molecular formula C22H25N3O6 and a molecular weight of 427.46 g/mol. Its IUPAC name is 6,7-dimethoxy-2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinazolin-4-one.
| Compound Name | 6,7-dimethoxy-2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 4516911 |
| Molecular Formula | C22H25N3O6 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | 6,7-dimethoxy-2-methyl-3-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]quinazolin-4-one |
| SMILES | COc1cc2nc(C)n(N=C(C)c3cc(OC)c(OC)c(OC)c3)c(=O)c2cc1OC |
| InChI | InChI=1S/C22H25N3O6/c1-12(14-8-19(29-5)21(31-7)20(9-14)30-6)24-25-13(2)23-16-11-18(28-4)17(27-3)10-15(16)22(25)26/h8-11H,1-7H3 |
| InChIKey | ALSSEVMWKKXCFB-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 93.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|