C25H27BrN2O3 — CID 137148270
2-bromo-6-[[(5R,7R)-3-(4-methylphenyl)-1-adamantyl]methyliminomethyl]-4-nitrophenol (PubChem CID 137148270) has the molecular formula C25H27BrN2O3 and a molecular weight of 483.41 g/mol. Its IUPAC name is 2-bromo-6-[[(5R,7R)-3-(4-methylphenyl)-1-adamantyl]methyliminomethyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[[(5R,7R)-3-(4-methylphenyl)-1-adamantyl]methyliminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 137148270 |
| Molecular Formula | C25H27BrN2O3 |
| Molecular Weight | 483.41 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | 2-bromo-6-[[(5R,7R)-3-(4-methylphenyl)-1-adamantyl]methyliminomethyl]-4-nitrophenol |
| SMILES | Cc1ccc(C23C[C@H]4C[C@@H](CC(C/N=C/c5cc([N+](=O)[O-])cc(Br)c5O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H27BrN2O3/c1-16-2-4-20(5-3-16)25-11-17-6-18(12-25)10-24(9-17,14-25)15-27-13-19-7-21(28(30)31)8-22(26)23(19)29/h2-5,7-8,13,17-18,29H,6,9-12,14-15H2,1H3/b27-13+/t17-,18-,24?,25?/m0/s1 |
| InChIKey | DAXUFLRMAOLTPA-CYFXJHSVSA-N |
| XLogP | 6.33 |
| TPSA | 75.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.41 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|