C25H26BrNO3 — CID 136698096
2-[(5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]-1-adamantyl]acetic acid (PubChem CID 136698096) has the molecular formula C25H26BrNO3 and a molecular weight of 468.39 g/mol. Its IUPAC name is 2-[(5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]-1-adamantyl]acetic acid.
| Compound Name | 2-[(5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]-1-adamantyl]acetic acid |
|---|---|
| PubChem CID | 136698096 |
| Molecular Formula | C25H26BrNO3 |
| Molecular Weight | 468.39 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-[(5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]-1-adamantyl]acetic acid |
| SMILES | O=C(O)CC12C[C@@H]3C[C@@H](C1)CC(c1ccc(/N=C/c4cc(Br)ccc4O)cc1)(C3)C2 |
| InChI | InChI=1S/C25H26BrNO3/c26-20-3-6-22(28)18(8-20)14-27-21-4-1-19(2-5-21)25-11-16-7-17(12-25)10-24(9-16,15-25)13-23(29)30/h1-6,8,14,16-17,28H,7,9-13,15H2,(H,29,30)/b27-14+/t16-,17-,24?,25?/m0/s1 |
| InChIKey | VPFNYCBSAUJYRW-SVGXVRIQSA-N |
| XLogP | 6.22 |
| TPSA | 69.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.39 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|