C23H24BrNO2 — CID 136910561
(5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]adamantan-1-ol (PubChem CID 136910561) has the molecular formula C23H24BrNO2 and a molecular weight of 426.35 g/mol. Its IUPAC name is (5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]adamantan-1-ol.
| Compound Name | (5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]adamantan-1-ol |
|---|---|
| PubChem CID | 136910561 |
| Molecular Formula | C23H24BrNO2 |
| Molecular Weight | 426.35 g/mol |
| Exact Mass | 425.10 |
| IUPAC Name | (5S,7S)-3-[4-[(5-bromo-2-hydroxyphenyl)methylideneamino]phenyl]adamantan-1-ol |
| SMILES | Oc1ccc(Br)cc1/C=N/c1ccc(C23C[C@@H]4C[C@H](CC(O)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C23H24BrNO2/c24-19-3-6-21(26)17(8-19)13-25-20-4-1-18(2-5-20)22-9-15-7-16(10-22)12-23(27,11-15)14-22/h1-6,8,13,15-16,26-27H,7,9-12,14H2/b25-13+/t15-,16-,22?,23?/m0/s1 |
| InChIKey | SKBIBFMWLDMRFV-ZYXZVSRBSA-N |
| XLogP | 5.49 |
| TPSA | 52.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.35 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|