C29H28ClNO — CID 136897175
4-chloro-2-[[4-[(5S,7R)-3-phenyl-1-adamantyl]phenyl]iminomethyl]phenol (PubChem CID 136897175) has the molecular formula C29H28ClNO and a molecular weight of 442.00 g/mol. Its IUPAC name is 4-chloro-2-[[4-[(5S,7R)-3-phenyl-1-adamantyl]phenyl]iminomethyl]phenol.
| Compound Name | 4-chloro-2-[[4-[(5S,7R)-3-phenyl-1-adamantyl]phenyl]iminomethyl]phenol |
|---|---|
| PubChem CID | 136897175 |
| Molecular Formula | C29H28ClNO |
| Molecular Weight | 442.00 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 4-chloro-2-[[4-[(5S,7R)-3-phenyl-1-adamantyl]phenyl]iminomethyl]phenol |
| SMILES | Oc1ccc(Cl)cc1/C=N/c1ccc(C23C[C@@H]4C[C@@H](CC(c5ccccc5)(C4)C2)C3)cc1 |
| InChI | InChI=1S/C29H28ClNO/c30-25-8-11-27(32)22(13-25)18-31-26-9-6-24(7-10-26)29-16-20-12-21(17-29)15-28(14-20,19-29)23-4-2-1-3-5-23/h1-11,13,18,20-21,32H,12,14-17,19H2/b31-18+/t20-,21+,28?,29? |
| InChIKey | QDRKFOPNKWCRGX-TUKNDEIHSA-N |
| XLogP | 7.59 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.00 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|