C37H35NO2 — CID 3952011
[4-[4-[[4-(3-phenyl-1-adamantyl)phenyl]iminomethyl]phenyl]phenyl] acetate (PubChem CID 3952011) has the molecular formula C37H35NO2 and a molecular weight of 525.69 g/mol. Its IUPAC name is [4-[4-[[4-(3-phenyl-1-adamantyl)phenyl]iminomethyl]phenyl]phenyl] acetate.
| Compound Name | [4-[4-[[4-(3-phenyl-1-adamantyl)phenyl]iminomethyl]phenyl]phenyl] acetate |
|---|---|
| PubChem CID | 3952011 |
| Molecular Formula | C37H35NO2 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.27 |
| IUPAC Name | [4-[4-[[4-(3-phenyl-1-adamantyl)phenyl]iminomethyl]phenyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(/C=N/c3ccc(C45CC6CC(CC(c7ccccc7)(C6)C4)C5)cc3)cc2)cc1 |
| InChI | InChI=1S/C37H35NO2/c1-26(39)40-35-17-11-31(12-18-35)30-9-7-27(8-10-30)24-38-34-15-13-33(14-16-34)37-22-28-19-29(23-37)21-36(20-28,25-37)32-5-3-2-4-6-32/h2-18,24,28-29H,19-23,25H2,1H3/b38-24+ |
| InChIKey | IGGFMCZWSQTWAY-RQXXSLPSSA-N |
| XLogP | 8.82 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|