C20H22N4O3S — CID 136678673
(2Z,5E)-5-[(4-nitrophenyl)methylidene]-2-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 136678673) has the molecular formula C20H22N4O3S and a molecular weight of 398.49 g/mol. Its IUPAC name is (2Z,5E)-5-[(4-nitrophenyl)methylidene]-2-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2Z,5E)-5-[(4-nitrophenyl)methylidene]-2-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 136678673 |
| Molecular Formula | C20H22N4O3S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (2Z,5E)-5-[(4-nitrophenyl)methylidene]-2-[(Z)-[(1R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC1(C)[C@H]2CC[C@@]1(C)/C(=N\N=C1\NC(=O)/C(=C\c3ccc([N+](=O)[O-])cc3)S1)C2 |
| InChI | InChI=1S/C20H22N4O3S/c1-19(2)13-8-9-20(19,3)16(11-13)22-23-18-21-17(25)15(28-18)10-12-4-6-14(7-5-12)24(26)27/h4-7,10,13H,8-9,11H2,1-3H3,(H,21,23,25)/b15-10+,22-16-/t13-,20-/m0/s1 |
| InChIKey | LQFAYIHXQNLLRS-WFWPZKHBSA-N |
| XLogP | 4.36 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|