C20H22BrN3OS — CID 135914572
(2E,5E)-5-[(3-bromophenyl)methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135914572) has the molecular formula C20H22BrN3OS and a molecular weight of 432.39 g/mol. Its IUPAC name is (2E,5E)-5-[(3-bromophenyl)methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | (2E,5E)-5-[(3-bromophenyl)methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135914572 |
| Molecular Formula | C20H22BrN3OS |
| Molecular Weight | 432.39 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | (2E,5E)-5-[(3-bromophenyl)methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC12CCC(CC1=N/N=C1\NC(=O)/C(=C\c3cccc(Br)c3)S1)C2(C)C |
| InChI | InChI=1S/C20H22BrN3OS/c1-19(2)13-7-8-20(19,3)16(11-13)23-24-18-22-17(25)15(26-18)10-12-5-4-6-14(21)9-12/h4-6,9-10,13H,7-8,11H2,1-3H3,(H,22,24,25)/b15-10+,23-16? |
| InChIKey | XGBYPXJUPDRINW-YXCGMMHFSA-N |
| XLogP | 5.21 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.39 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|