C28H28Cl3N3O3S — CID 135418836
5-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135418836) has the molecular formula C28H28Cl3N3O3S and a molecular weight of 592.98 g/mol. Its IUPAC name is 5-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135418836 |
| Molecular Formula | C28H28Cl3N3O3S |
| Molecular Weight | 592.98 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | 5-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(C=C2SC(=NN=C3CC4CCC3(C)C4(C)C)NC2=O)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C28H28Cl3N3O3S/c1-27(2)17-7-8-28(27,3)23(11-17)33-34-26-32-25(35)22(38-26)10-15-5-6-21(36-4)16(9-15)14-37-24-19(30)12-18(29)13-20(24)31/h5-6,9-10,12-13,17H,7-8,11,14H2,1-4H3,(H,32,34,35) |
| InChIKey | DTBWFIZYEJOMEF-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.98 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|