C24H23Cl2N3O2S — CID 135498361
5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one (PubChem CID 135498361) has the molecular formula C24H23Cl2N3O2S and a molecular weight of 488.44 g/mol. Its IUPAC name is 5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one.
| Compound Name | 5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 135498361 |
| Molecular Formula | C24H23Cl2N3O2S |
| Molecular Weight | 488.44 g/mol |
| Exact Mass | 487.09 |
| IUPAC Name | 5-[[5-(2,6-dichlorophenyl)furan-2-yl]methylidene]-2-[(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene)hydrazinylidene]-1,3-thiazolidin-4-one |
| SMILES | CC12CCC(CC1=NN=C1NC(=O)C(=Cc3ccc(-c4c(Cl)cccc4Cl)o3)S1)C2(C)C |
| InChI | InChI=1S/C24H23Cl2N3O2S/c1-23(2)13-9-10-24(23,3)19(11-13)28-29-22-27-21(30)18(32-22)12-14-7-8-17(31-14)20-15(25)5-4-6-16(20)26/h4-8,12-13H,9-11H2,1-3H3,(H,27,29,30) |
| InChIKey | MZIKMNHMDQHOIW-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 66.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.44 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|