C15H21N3 — CID 6901397
(E,E)-2-methyl-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine (PubChem CID 6901397) has the molecular formula C15H21N3 and a molecular weight of 243.35 g/mol. Its IUPAC name is (E,E)-2-methyl-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine.
| Compound Name | (E,E)-2-methyl-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6901397 |
| Molecular Formula | C15H21N3 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | (E,E)-2-methyl-N-(4-methylpiperazin-1-yl)-3-phenylprop-2-en-1-imine |
| SMILES | CC(/C=N/N1CCN(C)CC1)=C\c1ccccc1 |
| InChI | InChI=1S/C15H21N3/c1-14(12-15-6-4-3-5-7-15)13-16-18-10-8-17(2)9-11-18/h3-7,12-13H,8-11H2,1-2H3/b14-12+,16-13+ |
| InChIKey | WDJFFKOWRKMSSZ-ZAVUQCBESA-N |
| XLogP | 2.32 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|