C20H23BrN3+ — CID 6879956
(E,Z)-N-(4-benzylpiperazin-4-ium-1-yl)-2-bromo-3-phenylprop-2-en-1-imine (PubChem CID 6879956) has the molecular formula C20H23BrN3+ and a molecular weight of 385.33 g/mol. Its IUPAC name is (E,Z)-N-(4-benzylpiperazin-4-ium-1-yl)-2-bromo-3-phenylprop-2-en-1-imine.
| Compound Name | (E,Z)-N-(4-benzylpiperazin-4-ium-1-yl)-2-bromo-3-phenylprop-2-en-1-imine |
|---|---|
| PubChem CID | 6879956 |
| Molecular Formula | C20H23BrN3+ |
| Molecular Weight | 385.33 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | (E,Z)-N-(4-benzylpiperazin-4-ium-1-yl)-2-bromo-3-phenylprop-2-en-1-imine |
| SMILES | BrC(=C\c1ccccc1)/C=N/N1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H22BrN3/c21-20(15-18-7-3-1-4-8-18)16-22-24-13-11-23(12-14-24)17-19-9-5-2-6-10-19/h1-10,15-16H,11-14,17H2/p+1/b20-15-,22-16+ |
| InChIKey | DYNORDCFBLDDQF-IJDGKNKPSA-O |
| XLogP | 2.81 |
| TPSA | 20.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.33 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|