C25H30N3O+ — CID 7420750
(Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-1-(4-propoxyphenyl)methanimine (PubChem CID 7420750) has the molecular formula C25H30N3O+ and a molecular weight of 388.54 g/mol. Its IUPAC name is (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-1-(4-propoxyphenyl)methanimine.
| Compound Name | (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-1-(4-propoxyphenyl)methanimine |
|---|---|
| PubChem CID | 7420750 |
| Molecular Formula | C25H30N3O+ |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (Z)-N-[4-(naphthalen-1-ylmethyl)piperazin-4-ium-1-yl]-1-(4-propoxyphenyl)methanimine |
| SMILES | CCCOc1ccc(/C=N\N2CC[NH+](Cc3cccc4ccccc34)CC2)cc1 |
| InChI | InChI=1S/C25H29N3O/c1-2-18-29-24-12-10-21(11-13-24)19-26-28-16-14-27(15-17-28)20-23-8-5-7-22-6-3-4-9-25(22)23/h3-13,19H,2,14-18,20H2,1H3/p+1/b26-19- |
| InChIKey | PQESZVMKWRVOIM-XHPQRKPJSA-O |
| XLogP | 3.36 |
| TPSA | 29.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_pipzn(79)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|