C34H34ClN5O4 — CID 5100342
N-[[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide (PubChem CID 5100342) has the molecular formula C34H34ClN5O4 and a molecular weight of 612.13 g/mol. Its IUPAC name is N-[[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-[[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 5100342 |
| Molecular Formula | C34H34ClN5O4 |
| Molecular Weight | 612.13 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | N-[[4-[2-(3-chloroanilino)-2-oxoethoxy]phenyl]methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
| SMILES | COc1ccccc1N1CCN(Cc2ccc(C(=O)NN=Cc3ccc(OCC(=O)Nc4cccc(Cl)c4)cc3)cc2)CC1 |
| InChI | InChI=1S/C34H34ClN5O4/c1-43-32-8-3-2-7-31(32)40-19-17-39(18-20-40)23-26-9-13-27(14-10-26)34(42)38-36-22-25-11-15-30(16-12-25)44-24-33(41)37-29-6-4-5-28(35)21-29/h2-16,21-22H,17-20,23-24H2,1H3,(H,37,41)(H,38,42) |
| InChIKey | HQORQKWJJULMIS-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.13 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|