C30H33BrN4O4 — CID 6029525
N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide (PubChem CID 6029525) has the molecular formula C30H33BrN4O4 and a molecular weight of 593.52 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
|---|---|
| PubChem CID | 6029525 |
| Molecular Formula | C30H33BrN4O4 |
| Molecular Weight | 593.52 g/mol |
| Exact Mass | 592.17 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]benzamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)c2ccc(CN3CCN(c4ccccc4OC)CC3)cc2)cc1OC |
| InChI | InChI=1S/C30H33BrN4O4/c1-4-17-39-29-25(31)18-23(19-28(29)38-3)20-32-33-30(36)24-11-9-22(10-12-24)21-34-13-15-35(16-14-34)26-7-5-6-8-27(26)37-2/h4-12,18-20H,1,13-17,21H2,2-3H3,(H,33,36)/b32-20- |
| InChIKey | KPOTZNAPAXDRGU-RGXNXFOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.52 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|