C26H25BrClN3O5S — CID 124535029
N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide (PubChem CID 124535029) has the molecular formula C26H25BrClN3O5S and a molecular weight of 606.93 g/mol. Its IUPAC name is N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide.
| Compound Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide |
|---|---|
| PubChem CID | 124535029 |
| Molecular Formula | C26H25BrClN3O5S |
| Molecular Weight | 606.93 g/mol |
| Exact Mass | 605.04 |
| IUPAC Name | N-[(Z)-(3-bromo-5-methoxy-4-prop-2-enoxyphenyl)methylideneamino]-4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzamide |
| SMILES | C=CCOc1c(Br)cc(/C=N\NC(=O)c2ccc(N(Cc3ccc(Cl)cc3)S(C)(=O)=O)cc2)cc1OC |
| InChI | InChI=1S/C26H25BrClN3O5S/c1-4-13-36-25-23(27)14-19(15-24(25)35-2)16-29-30-26(32)20-7-11-22(12-8-20)31(37(3,33)34)17-18-5-9-21(28)10-6-18/h4-12,14-16H,1,13,17H2,2-3H3,(H,30,32)/b29-16- |
| InChIKey | KISOCKATYLZGIV-MWLSYYOVSA-N |
| XLogP | 5.41 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.93 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|