C24H22ClN3O6S — CID 92649444
2-[4-[(Z)-[[4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid (PubChem CID 92649444) has the molecular formula C24H22ClN3O6S and a molecular weight of 515.98 g/mol. Its IUPAC name is 2-[4-[(Z)-[[4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[4-[(Z)-[[4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 92649444 |
| Molecular Formula | C24H22ClN3O6S |
| Molecular Weight | 515.98 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 2-[4-[(Z)-[[4-[(4-chlorophenyl)methyl-methylsulfonylamino]benzoyl]hydrazinylidene]methyl]phenoxy]acetic acid |
| SMILES | CS(=O)(=O)N(Cc1ccc(Cl)cc1)c1ccc(C(=O)N/N=C\c2ccc(OCC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C24H22ClN3O6S/c1-35(32,33)28(15-18-2-8-20(25)9-3-18)21-10-6-19(7-11-21)24(31)27-26-14-17-4-12-22(13-5-17)34-16-23(29)30/h2-14H,15-16H2,1H3,(H,27,31)(H,29,30)/b26-14- |
| InChIKey | OSXZRIMEHXFAID-WGARJPEWSA-N |
| XLogP | 3.53 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|