C33H34N4O5S — CID 126031440
4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]benzamide (PubChem CID 126031440) has the molecular formula C33H34N4O5S and a molecular weight of 598.73 g/mol. Its IUPAC name is 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]benzamide.
| Compound Name | 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 126031440 |
| Molecular Formula | C33H34N4O5S |
| Molecular Weight | 598.73 g/mol |
| Exact Mass | 598.22 |
| IUPAC Name | 4-[(4-methylphenyl)methyl-methylsulfonylamino]-N-[(Z)-[4-[2-oxo-2-(2-phenylethylamino)ethoxy]phenyl]methylideneamino]benzamide |
| SMILES | Cc1ccc(CN(c2ccc(C(=O)N/N=C\c3ccc(OCC(=O)NCCc4ccccc4)cc3)cc2)S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C33H34N4O5S/c1-25-8-10-28(11-9-25)23-37(43(2,40)41)30-16-14-29(15-17-30)33(39)36-35-22-27-12-18-31(19-13-27)42-24-32(38)34-21-20-26-6-4-3-5-7-26/h3-19,22H,20-21,23-24H2,1-2H3,(H,34,38)(H,36,39)/b35-22- |
| InChIKey | IIZQRRQZMSIZRF-QHDYCIAZSA-N |
| XLogP | 4.46 |
| TPSA | 117.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.73 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|