C22H23ClN4O3S — CID 126128115
N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide (PubChem CID 126128115) has the molecular formula C22H23ClN4O3S and a molecular weight of 458.97 g/mol. Its IUPAC name is N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide.
| Compound Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
|---|---|
| PubChem CID | 126128115 |
| Molecular Formula | C22H23ClN4O3S |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | N-[(Z)-[1-(2-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-4-[methyl(methylsulfonyl)amino]benzamide |
| SMILES | Cc1cc(/C=N\NC(=O)c2ccc(N(C)S(C)(=O)=O)cc2)c(C)n1-c1ccccc1Cl |
| InChI | InChI=1S/C22H23ClN4O3S/c1-15-13-18(16(2)27(15)21-8-6-5-7-20(21)23)14-24-25-22(28)17-9-11-19(12-10-17)26(3)31(4,29)30/h5-14H,1-4H3,(H,25,28)/b24-14- |
| InChIKey | WONNFHREIQNEJW-OYKKKHCWSA-N |
| XLogP | 3.91 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|