C31H31F3N4O3S — CID 3128305
4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide (PubChem CID 3128305) has the molecular formula C31H31F3N4O3S and a molecular weight of 596.68 g/mol. Its IUPAC name is 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide.
| Compound Name | 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide |
|---|---|
| PubChem CID | 3128305 |
| Molecular Formula | C31H31F3N4O3S |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]-N-[[2,5-dimethyl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]methylideneamino]benzamide |
| SMILES | Cc1ccc(N(Cc2ccc(C(=O)NN=Cc3cc(C)n(-c4ccccc4C(F)(F)F)c3C)cc2)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C31H31F3N4O3S/c1-20-10-15-27(16-21(20)2)37(42(5,40)41)19-24-11-13-25(14-12-24)30(39)36-35-18-26-17-22(3)38(23(26)4)29-9-7-6-8-28(29)31(32,33)34/h6-18H,19H2,1-5H3,(H,36,39) |
| InChIKey | BEHQMLBIQZIKGI-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 83.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|