C22H21N3O2 — CID 3525389
4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-(furan-2-ylmethylideneamino)benzamide (PubChem CID 3525389) has the molecular formula C22H21N3O2 and a molecular weight of 359.43 g/mol. Its IUPAC name is 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-(furan-2-ylmethylideneamino)benzamide.
| Compound Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-(furan-2-ylmethylideneamino)benzamide |
|---|---|
| PubChem CID | 3525389 |
| Molecular Formula | C22H21N3O2 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | 4-(3,4-dihydro-1H-isoquinolin-2-ylmethyl)-N-(furan-2-ylmethylideneamino)benzamide |
| SMILES | O=C(NN=Cc1ccco1)c1ccc(CN2CCc3ccccc3C2)cc1 |
| InChI | InChI=1S/C22H21N3O2/c26-22(24-23-14-21-6-3-13-27-21)19-9-7-17(8-10-19)15-25-12-11-18-4-1-2-5-20(18)16-25/h1-10,13-14H,11-12,15-16H2,(H,24,26) |
| InChIKey | SPHVFCZCSAXCSQ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|