C23H23N3O2S — CID 50754186
4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(thiophen-2-ylmethyl)benzamide (PubChem CID 50754186) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(thiophen-2-ylmethyl)benzamide.
| Compound Name | 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(thiophen-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 50754186 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(thiophen-2-ylmethyl)benzamide |
| SMILES | O=C(NCc1cccs1)c1ccc(N2CCCN(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c27-22(24-16-21-8-4-15-29-21)19-9-11-20(12-10-19)26-14-5-13-25(23(26)28)17-18-6-2-1-3-7-18/h1-4,6-12,15H,5,13-14,16-17H2,(H,24,27) |
| InChIKey | JUIQJJBAFPTRAX-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |