C21H24FN3O3 — CID 50813792
4-[3-[(4-fluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]-N-(2-methoxyethyl)benzamide (PubChem CID 50813792) has the molecular formula C21H24FN3O3 and a molecular weight of 385.44 g/mol. Its IUPAC name is 4-[3-[(4-fluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[3-[(4-fluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 50813792 |
| Molecular Formula | C21H24FN3O3 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 4-[3-[(4-fluorophenyl)methyl]-2-oxo-1,3-diazinan-1-yl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(N2CCCN(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H24FN3O3/c1-28-14-11-23-20(26)17-5-9-19(10-6-17)25-13-2-12-24(21(25)27)15-16-3-7-18(22)8-4-16/h3-10H,2,11-15H2,1H3,(H,23,26) |
| InChIKey | YBXBWNTWZKXECI-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|