C22H21Cl2N3O2 — CID 42650272
N-[(3,4-dichlorophenyl)methyl]-1-(1H-indole-5-carbonyl)piperidine-3-carboxamide (PubChem CID 42650272) has the molecular formula C22H21Cl2N3O2 and a molecular weight of 430.34 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-1-(1H-indole-5-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-1-(1H-indole-5-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42650272 |
| Molecular Formula | C22H21Cl2N3O2 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-1-(1H-indole-5-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)c(Cl)c1)C1CCCN(C(=O)c2ccc3[nH]ccc3c2)C1 |
| InChI | InChI=1S/C22H21Cl2N3O2/c23-18-5-3-14(10-19(18)24)12-26-21(28)17-2-1-9-27(13-17)22(29)16-4-6-20-15(11-16)7-8-25-20/h3-8,10-11,17,25H,1-2,9,12-13H2,(H,26,28) |
| InChIKey | YBQHSCWTXAOCFP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |