C22H25Cl2N5O3 — CID 122603688
5-(4-acetylpiperazin-1-yl)-2-amino-N-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]benzamide (PubChem CID 122603688) has the molecular formula C22H25Cl2N5O3 and a molecular weight of 478.38 g/mol. Its IUPAC name is 5-(4-acetylpiperazin-1-yl)-2-amino-N-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]benzamide.
| Compound Name | 5-(4-acetylpiperazin-1-yl)-2-amino-N-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 122603688 |
| Molecular Formula | C22H25Cl2N5O3 |
| Molecular Weight | 478.38 g/mol |
| Exact Mass | 477.13 |
| IUPAC Name | 5-(4-acetylpiperazin-1-yl)-2-amino-N-[2-[(3,4-dichlorophenyl)methylamino]-2-oxoethyl]benzamide |
| SMILES | CC(=O)N1CCN(c2ccc(N)c(C(=O)NCC(=O)NCc3ccc(Cl)c(Cl)c3)c2)CC1 |
| InChI | InChI=1S/C22H25Cl2N5O3/c1-14(30)28-6-8-29(9-7-28)16-3-5-20(25)17(11-16)22(32)27-13-21(31)26-12-15-2-4-18(23)19(24)10-15/h2-5,10-11H,6-9,12-13,25H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | XTYIFCRALUMGCF-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.38 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|