C16H20N4O6 — CID 122603565
methyl 2-[[5-(4-acetylpiperazin-1-yl)-2-nitrobenzoyl]amino]acetate (PubChem CID 122603565) has the molecular formula C16H20N4O6 and a molecular weight of 364.36 g/mol. Its IUPAC name is methyl 2-[[5-(4-acetylpiperazin-1-yl)-2-nitrobenzoyl]amino]acetate.
| Compound Name | methyl 2-[[5-(4-acetylpiperazin-1-yl)-2-nitrobenzoyl]amino]acetate |
|---|---|
| PubChem CID | 122603565 |
| Molecular Formula | C16H20N4O6 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 2-[[5-(4-acetylpiperazin-1-yl)-2-nitrobenzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(N2CCN(C(C)=O)CC2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H20N4O6/c1-11(21)18-5-7-19(8-6-18)12-3-4-14(20(24)25)13(9-12)16(23)17-10-15(22)26-2/h3-4,9H,5-8,10H2,1-2H3,(H,17,23) |
| InChIKey | BGCNLNSRBRKQTI-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|