C10H9BrN2O5 — CID 122603655
methyl 2-[(5-bromo-2-nitrobenzoyl)amino]acetate (PubChem CID 122603655) has the molecular formula C10H9BrN2O5 and a molecular weight of 317.10 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-nitrobenzoyl)amino]acetate.
| Compound Name | methyl 2-[(5-bromo-2-nitrobenzoyl)amino]acetate |
|---|---|
| PubChem CID | 122603655 |
| Molecular Formula | C10H9BrN2O5 |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | methyl 2-[(5-bromo-2-nitrobenzoyl)amino]acetate |
| SMILES | COC(=O)CNC(=O)c1cc(Br)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9BrN2O5/c1-18-9(14)5-12-10(15)7-4-6(11)2-3-8(7)13(16)17/h2-4H,5H2,1H3,(H,12,15) |
| InChIKey | MZQQSZUJVDBZOP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|