C15H26N2S — CID 62591872
2-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]propan-2-amine (PubChem CID 62591872) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is 2-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]propan-2-amine.
| Compound Name | 2-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 62591872 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | 2-methyl-N-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]propan-2-amine |
| SMILES | CC(C)(C)NCC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C15H26N2S/c1-15(2,3)16-11-13-6-8-17(9-7-13)12-14-5-4-10-18-14/h4-5,10,13,16H,6-9,11-12H2,1-3H3 |
| InChIKey | OYPDZNVKANCHAW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |