C19H28N6S2 — CID 111084395
4-(1,3-thiazol-2-yl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide (PubChem CID 111084395) has the molecular formula C19H28N6S2 and a molecular weight of 404.61 g/mol. Its IUPAC name is 4-(1,3-thiazol-2-yl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide.
| Compound Name | 4-(1,3-thiazol-2-yl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111084395 |
| Molecular Formula | C19H28N6S2 |
| Molecular Weight | 404.61 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 4-(1,3-thiazol-2-yl)-N'-[[1-(thiophen-2-ylmethyl)piperidin-3-yl]methyl]piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCCN(Cc2cccs2)C1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H28N6S2/c20-18(24-7-9-25(10-8-24)19-21-5-12-27-19)22-13-16-3-1-6-23(14-16)15-17-4-2-11-26-17/h2,4-5,11-12,16H,1,3,6-10,13-15H2,(H2,20,22) |
| InChIKey | GJOGBTRGMMQZPZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|