C19H25BrN6S — CID 111076762
N'-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide (PubChem CID 111076762) has the molecular formula C19H25BrN6S and a molecular weight of 449.42 g/mol. Its IUPAC name is N'-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide.
| Compound Name | N'-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111076762 |
| Molecular Formula | C19H25BrN6S |
| Molecular Weight | 449.42 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | N'-[[1-(4-bromophenyl)pyrrolidin-3-yl]methyl]-4-(1,3-thiazol-2-yl)piperazine-1-carboximidamide |
| SMILES | N/C(=N\CC1CCN(c2ccc(Br)cc2)C1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C19H25BrN6S/c20-16-1-3-17(4-2-16)26-7-5-15(14-26)13-23-18(21)24-8-10-25(11-9-24)19-22-6-12-27-19/h1-4,6,12,15H,5,7-11,13-14H2,(H2,21,23) |
| InChIKey | OBAUIWLYQPHMIA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|