C19H33IN6O2S — CID 111083010
tert-butyl 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide (PubChem CID 111083010) has the molecular formula C19H33IN6O2S and a molecular weight of 536.48 g/mol. Its IUPAC name is tert-butyl 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide.
| Compound Name | tert-butyl 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111083010 |
| Molecular Formula | C19H33IN6O2S |
| Molecular Weight | 536.48 g/mol |
| Exact Mass | 536.14 |
| IUPAC Name | tert-butyl 3-[[[amino-[4-(1,3-thiazol-2-yl)piperazin-1-yl]methylidene]amino]methyl]piperidine-1-carboxylate;hydroiodide |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C/N=C(\N)N2CCN(c3nccs3)CC2)C1.I |
| InChI | InChI=1S/C19H32N6O2S.HI/c1-19(2,3)27-18(26)25-7-4-5-15(14-25)13-22-16(20)23-8-10-24(11-9-23)17-21-6-12-28-17;/h6,12,15H,4-5,7-11,13-14H2,1-3H3,(H2,20,22);1H |
| InChIKey | WZJCRXRKCDFLPZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 87.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.48 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|