C21H29IN4S — CID 111084462
1-(2,3-dihydro-1H-inden-5-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111084462) has the molecular formula C21H29IN4S and a molecular weight of 496.46 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111084462 |
| Molecular Formula | C21H29IN4S |
| Molecular Weight | 496.46 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-2-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(Cc2cccs2)CC1)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C21H28N4S.HI/c22-21(24-19-7-6-17-3-1-4-18(17)13-19)23-14-16-8-10-25(11-9-16)15-20-5-2-12-26-20;/h2,5-7,12-13,16H,1,3-4,8-11,14-15H2,(H3,22,23,24);1H |
| InChIKey | FFMKKTYPGDBYBA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|