C12H22IN3OS — CID 111823890
1,1-diethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide (PubChem CID 111823890) has the molecular formula C12H22IN3OS and a molecular weight of 383.30 g/mol. Its IUPAC name is 1,1-diethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide.
| Compound Name | 1,1-diethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111823890 |
| Molecular Formula | C12H22IN3OS |
| Molecular Weight | 383.30 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 1,1-diethyl-2-(2-hydroxy-2-thiophen-2-ylpropyl)guanidine;hydroiodide |
| SMILES | CCN(CC)/C(N)=N/CC(C)(O)c1cccs1.I |
| InChI | InChI=1S/C12H21N3OS.HI/c1-4-15(5-2)11(13)14-9-12(3,16)10-7-6-8-17-10;/h6-8,16H,4-5,9H2,1-3H3,(H2,13,14);1H |
| InChIKey | OVTAILNYKNVVPB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.30 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|