C22H30N4O2 — CID 111803961
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine (PubChem CID 111803961) has the molecular formula C22H30N4O2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine.
| Compound Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111803961 |
| Molecular Formula | C22H30N4O2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.24 |
| IUPAC Name | 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
| SMILES | CC(NC(C)(C)C/N=C(\N)Nc1ccc2c(c1)OCCCO2)c1ccccc1 |
| InChI | InChI=1S/C22H30N4O2/c1-16(17-8-5-4-6-9-17)26-22(2,3)15-24-21(23)25-18-10-11-19-20(14-18)28-13-7-12-27-19/h4-6,8-11,14,16,26H,7,12-13,15H2,1-3H3,(H3,23,24,25) |
| InChIKey | TUTUUEDGJAKZBG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|