C21H30N4O2 — CID 111803947
1-(3,4-dimethoxyphenyl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine (PubChem CID 111803947) has the molecular formula C21H30N4O2 and a molecular weight of 370.50 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111803947 |
| Molecular Formula | C21H30N4O2 |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[2-methyl-2-(1-phenylethylamino)propyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/CC(C)(C)NC(C)c2ccccc2)cc1OC |
| InChI | InChI=1S/C21H30N4O2/c1-15(16-9-7-6-8-10-16)25-21(2,3)14-23-20(22)24-17-11-12-18(26-4)19(13-17)27-5/h6-13,15,25H,14H2,1-5H3,(H3,22,23,24) |
| InChIKey | QJSLECWUOLSTTD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|