C20H34N4O2 — CID 111042483
2-[2-(diethylamino)-4-methylpentyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine (PubChem CID 111042483) has the molecular formula C20H34N4O2 and a molecular weight of 362.52 g/mol. Its IUPAC name is 2-[2-(diethylamino)-4-methylpentyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine.
| Compound Name | 2-[2-(diethylamino)-4-methylpentyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
|---|---|
| PubChem CID | 111042483 |
| Molecular Formula | C20H34N4O2 |
| Molecular Weight | 362.52 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 2-[2-(diethylamino)-4-methylpentyl]-1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)guanidine |
| SMILES | CCN(CC)C(C/N=C(\N)Nc1ccc2c(c1)OCCCO2)CC(C)C |
| InChI | InChI=1S/C20H34N4O2/c1-5-24(6-2)17(12-15(3)4)14-22-20(21)23-16-8-9-18-19(13-16)26-11-7-10-25-18/h8-9,13,15,17H,5-7,10-12,14H2,1-4H3,(H3,21,22,23) |
| InChIKey | QROAAYLHVNXHPQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.52 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|