C18H25ClN4O3 — CID 60563659
2-acetamido-N-[2-[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]acetamide (PubChem CID 60563659) has the molecular formula C18H25ClN4O3 and a molecular weight of 380.88 g/mol. Its IUPAC name is 2-acetamido-N-[2-[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]acetamide.
| Compound Name | 2-acetamido-N-[2-[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 60563659 |
| Molecular Formula | C18H25ClN4O3 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | 2-acetamido-N-[2-[[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl]acetamide |
| SMILES | CC(=O)NCC(=O)NCC(=O)NCC(c1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C18H25ClN4O3/c1-13(24)20-11-17(25)22-12-18(26)21-10-16(23-7-2-3-8-23)14-5-4-6-15(19)9-14/h4-6,9,16H,2-3,7-8,10-12H2,1H3,(H,20,24)(H,21,26)(H,22,25) |
| InChIKey | MPHWQOZBSAVZEJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |