C21H25ClN2O — CID 112506817
N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide (PubChem CID 112506817) has the molecular formula C21H25ClN2O and a molecular weight of 356.90 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide.
| Compound Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 112506817 |
| Molecular Formula | C21H25ClN2O |
| Molecular Weight | 356.90 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[2-(3-chlorophenyl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NCC(c1cccc(Cl)c1)N1CCCC1 |
| InChI | InChI=1S/C21H25ClN2O/c22-19-10-6-9-18(15-19)20(24-13-4-5-14-24)16-23-21(25)12-11-17-7-2-1-3-8-17/h1-3,6-10,15,20H,4-5,11-14,16H2,(H,23,25) |
| InChIKey | HPPAJPIMDVLHFD-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.90 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |