C23H30N2O2 — CID 124846032
N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 124846032) has the molecular formula C23H30N2O2 and a molecular weight of 366.51 g/mol. Its IUPAC name is N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 124846032 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | N-[(2R)-2-(azepan-1-yl)-2-phenylethyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | O=C(CCc1ccc(O)cc1)NC[C@@H](c1ccccc1)N1CCCCCC1 |
| InChI | InChI=1S/C23H30N2O2/c26-21-13-10-19(11-14-21)12-15-23(27)24-18-22(20-8-4-3-5-9-20)25-16-6-1-2-7-17-25/h3-5,8-11,13-14,22,26H,1-2,6-7,12,15-18H2,(H,24,27)/t22-/m0/s1 |
| InChIKey | IBIBZHFVAGLXOR-QFIPXVFZSA-N |
| XLogP | 4.06 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |