C22H26N2O3 — CID 42457175
N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide (PubChem CID 42457175) has the molecular formula C22H26N2O3 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide.
| Compound Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 42457175 |
| Molecular Formula | C22H26N2O3 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | N-[(2S)-2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylpropanamide |
| SMILES | O=C(CCc1ccccc1)NC[C@H](c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C22H26N2O3/c25-22(11-8-17-6-2-1-3-7-17)23-15-19(24-12-4-5-13-24)18-9-10-20-21(14-18)27-16-26-20/h1-3,6-7,9-10,14,19H,4-5,8,11-13,15-16H2,(H,23,25)/t19-/m1/s1 |
| InChIKey | JYSQIZHPCBVPAA-LJQANCHMSA-N |
| XLogP | 3.30 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |