C21H25N3O3 — CID 110354126
1-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-benzylurea (PubChem CID 110354126) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-benzylurea.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-benzylurea |
|---|---|
| PubChem CID | 110354126 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-benzylurea |
| SMILES | O=C(NCc1ccccc1)NCC(c1ccc2c(c1)OCO2)N1CCCC1 |
| InChI | InChI=1S/C21H25N3O3/c25-21(22-13-16-6-2-1-3-7-16)23-14-18(24-10-4-5-11-24)17-8-9-19-20(12-17)27-15-26-19/h1-3,6-9,12,18H,4-5,10-11,13-15H2,(H2,22,23,25) |
| InChIKey | NPVMSZUBUAUJBK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |