C23H28N2O3 — CID 110427617
N-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylbutanamide (PubChem CID 110427617) has the molecular formula C23H28N2O3 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylbutanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 110427617 |
| Molecular Formula | C23H28N2O3 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)-2-pyrrolidin-1-ylethyl]-3-phenylbutanamide |
| SMILES | CC(CC(=O)NCC(c1ccc2c(c1)OCO2)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C23H28N2O3/c1-17(18-7-3-2-4-8-18)13-23(26)24-15-20(25-11-5-6-12-25)19-9-10-21-22(14-19)28-16-27-21/h2-4,7-10,14,17,20H,5-6,11-13,15-16H2,1H3,(H,24,26) |
| InChIKey | NWVJNXICKJAFRW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |